trans-11-Octadecenoic acid methyl ester
- Product Nametrans-11-Octadecenoic acid methyl ester
- CAS6198-58-9
- MFC19H36O2
- MW296.49
- EINECS228-251-3
- MOL File6198-58-9.mol
Chemical Properties
| Melting point | 10°C(lit.) |
| Boiling point | 154°C/1mmHg(lit.) |
| Density | 0.873±0.06 g/cm3(Predicted) |
| refractive index | 1.4500 to 1.4540 |
| Flash point | -4 °C |
| storage temp. | -20°C |
| solubility | DMF: 30 mg/ml; DMSO: 30 mg/ml; Ethanol: 50 mg/ml |
| form | liquid |
| color | Colorless to Light yellow |
| biological source | synthetic (organic) |
| InChI | 1S/C19H36O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21-2/h8-9H,3-7,10-18H2,1-2H3/b9-8+ |
| InChIKey | PVVODBCDJBGMJL-CMDGGOBGSA-N |
| SMILES | [H]\C(CCCCCC)=C(\[H])CCCCCCCCCC(=O)OC |
| LogP | 8.160 (est) |
Safety Information
| Hazard Codes | Xi,N,Xn,F |
| Risk Statements | 36/37/38-67-65-50/53-38-11 |
| Safety Statements | 26-36-62-61-60-33-29-16-9 |
| RIDADR | UN 1206 3/PG 2 |
| WGK Germany | 1 |
| HS Code | 2916.19.5000 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |