Bis(dimethylamino)methylsilane
- Product NameBis(dimethylamino)methylsilane
- CAS22705-33-5
- MFC5H16N2Si
- MW132.28
- EINECS245-163-0
- MOL File22705-33-5.mol
Chemical Properties
| Melting point | <0°C |
| Boiling point | 112 °C |
| Density | 0.798 g/mL at 20 °C(lit.) |
| refractive index | n |
| Flash point | -3°C |
| pka | 10.24±0.70(Predicted) |
| Specific Gravity | 0.798 |
| Hydrolytic Sensitivity | 9: reacts extremely rapidly with atmospheric moisture - may be pyrophoric - glove box or sealed system required |
| InChI | InChI=1S/C5H16N2Si/c1-6(2)8(5)7(3)4/h8H,1-5H3 |
| InChIKey | VBYLGQXERITIBP-UHFFFAOYSA-N |
| SMILES | [SiH](C)(N(C)C)N(C)C |
| EPA Substance Registry System | Silanediamine, N,N,N',N',1-pentamethyl- (22705-33-5) |
Safety Information
| Hazard Codes | F,C |
| Risk Statements | 11-34 |
| Safety Statements | 16-26-36/37/39-45 |
| RIDADR | UN 2924 3/PG 2 |
| WGK Germany | 3 |
| F | 10-21 |
| TSCA | TSCA listed |