Methyl-DL-serine hydrochloride
- Product NameMethyl-DL-serine hydrochloride
- CAS5619-04-5
- MFC4H10ClNO3
- MW155.58
- EINECS227-047-1
- MOL File5619-04-5.mol
Chemical Properties
| Melting point | 134-136 °C(lit.) |
| Density | 1.37g/cm3 at 20℃ |
| storage temp. | -20°C |
| solubility | Methanol, Water |
| form | Solid |
| color | White to Off-White |
| Sensitive | Moisture Sensitive |
| BRN | 6067970 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C4H9NO3.ClH/c1-8-4(7)3(5)2-6;/h3,6H,2,5H2,1H3;1H |
| InChIKey | NDBQJIBNNUJNHA-UHFFFAOYSA-N |
| SMILES | C(N)(CO)C(=O)OC.Cl |
| LogP | -2 at 20℃ and pH7 |
| Surface tension | 76mN/m at 1g/L and 20℃ |
| CAS DataBase Reference | 5619-04-5(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-24/25 |
| WGK Germany | 3 |
| HS Code | 29225000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |