1-Hydroxypyrene
- Product Name1-Hydroxypyrene
- CAS5315-79-7
- MFC16H10O
- MW218.25
- EINECS624-224-9
- MOL File5315-79-7.mol
Chemical Properties
| Melting point | 179-182 °C (lit.) |
| Boiling point | 298.94°C (rough estimate) |
| Density | 1.1146 (rough estimate) |
| refractive index | 1.4600 (estimate) |
| storage temp. | 2-8°C |
| solubility | Dichloromethane (Very Slightly), DMSO (Slightly), Methanol (Slightly) |
| form | Fine Needles or Powder |
| pka | 9.40±0.30(Predicted) |
| color | Beige to brown |
| Stability | May be Light Sensitive |
| InChI | InChI=1S/C16H10O/c17-14-9-7-12-5-4-10-2-1-3-11-6-8-13(14)16(12)15(10)11/h1-9,17H |
| InChIKey | BIJNHUAPTJVVNQ-UHFFFAOYSA-N |
| SMILES | C1(O)=C2C3=C4C(C=C2)=CC=CC4=CC=C3C=C1 |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| RTECS | UR2845000 |
| HS Code | 29029090 |
| Storage Class | 11 - Combustible Solids |