3,5-Dimethylphenyl isocyanate
- Product Name3,5-Dimethylphenyl isocyanate
- CAS54132-75-1
- MFC9H9NO
- MW147.17
- EINECS258-987-0
- MOL File54132-75-1.mol
Chemical Properties
| Boiling point | 75 °C (5 mmHg) |
| Density | 1.045 g/mL at 25 °C (lit.) |
| vapor pressure | 0.2 psi ( 20 °C) |
| refractive index | n |
| Flash point | 183 °F |
| storage temp. | 2-8°C |
| form | clear liquid |
| color | Colorless to Yellow to Orange |
| Water Solubility | Hydrolyzes in water. |
| Sensitive | Moisture Sensitive |
| BRN | 774958 |
| InChI | InChI=1S/C9H9NO/c1-7-3-8(2)5-9(4-7)10-6-11/h3-5H,1-2H3 |
| InChIKey | DZSGDHNHQAJZCO-UHFFFAOYSA-N |
| SMILES | C1(N=C=O)=CC(C)=CC(C)=C1 |
| CAS DataBase Reference | 54132-75-1(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 23-26-27-28-37/39 |
| RIDADR | UN 2206 6.1/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Harmful |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29291090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Resp. Sens. 1 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |
