| Melting point |
76.2-77 °C |
| Boiling point |
90-92 °C12 mm Hg(lit.) |
| Density |
1.190 g/mL at 20 °C(lit.) |
| refractive index |
n20/D 1.439 |
| Flash point |
112°C |
| Water Solubility |
Soluble in water |
| form |
clear liquid |
| pka |
2.86(at RT℃) |
| color |
Colorless to Light orange to Yellow |
| BRN |
1720944 |
| InChI |
InChI=1S/C4H7ClO2/c1-2-3(5)4(6)7/h3H,2H2,1H3,(H,6,7) |
| InChIKey |
RVBUZBPJAGZHSQ-UHFFFAOYSA-N |
| SMILES |
C(O)(=O)C(Cl)CC |
| CAS DataBase Reference |
4170-24-5(CAS DataBase Reference) |
| NIST Chemistry Reference |
Butanoic acid, 2-chloro-(4170-24-5) |
