Boc-Dap(Fmoc)-OH
- Product NameBoc-Dap(Fmoc)-OH
- CAS122235-70-5
- MFC23H26N2O6
- MW426.46
- EINECS1533716-785-6
- MOL File122235-70-5.mol
Chemical Properties
| Melting point | 81-89° (dec.) |
| Boiling point | 652.5±55.0 °C(Predicted) |
| Density | 1.263±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Soluble in 2ml dimethyl formamide 0.3gram. |
| form | solid |
| pka | 3+-.0.10(Predicted) |
| Appearance | White to off-white Solid |
| optical activity | Consistent with structure |
| BRN | 4771385 |
| Major Application | peptide synthesis |
| InChIKey | MVWPBNQGEGBGRF-IBGZPJMESA-N |
| SMILES | C(O)(=O)[C@H](CNC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O)NC(OC(C)(C)C)=O |
Safety Information
| Hazard Codes | Xi |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |
