4′-Methylbiphenyl-2-carboxylic acid methyl ester
- Product Name4′-Methylbiphenyl-2-carboxylic acid methyl ester
- CAS114772-34-8
- MFC15H14O2
- MW226.27
- EINECS
- MOL File114772-34-8.mol
Chemical Properties
| Melting point | 60-61°C |
| Boiling point | 359.4±21.0 °C(Predicted) |
| Density | 1.083±0.06 g/cm3(Predicted) |
| solubility | soluble in Toluene |
| form | powder to crystal |
| color | White to Light yellow |
| InChI | InChI=1S/C15H14O2/c1-11-7-9-12(10-8-11)13-5-3-4-6-14(13)15(16)17-2/h3-10H,1-2H3 |
| InChIKey | IHNIAWHITVGYJJ-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=C(C)C=C2)=CC=CC=C1C(OC)=O |
| CAS DataBase Reference | 114772-34-8(CAS DataBase Reference) |
Safety Information
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | WGK 3 |
| HS Code | 2916399090 |
| Storage Class | 11 - Combustible Solids |
