| Melting point |
168 °C (dec.)(lit.) |
| alpha |
-24 º (c=1 in 6 M HCl) |
| Boiling point |
616.7±55.0 °C(Predicted) |
| Density |
1.368±0.06 g/cm3(Predicted) |
| refractive index |
-23.5 ° (C=6, 6mol/L HCl) |
| storage temp. |
Sealed in dry,2-8°C |
| solubility |
Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form |
powder to crystal |
| pka |
3.35±0.10(Predicted) |
| color |
White to Almost white |
| optical activity |
[α]20/D 24°, c = 1% in 6 M HCl |
| Water Solubility |
almost transparency |
| BRN |
3561682 |
| Major Application |
peptide synthesis |
| InChI |
1S/C14H15N3O4/c18-13(19)12(6-11-7-15-9-16-11)17-14(20)21-8-10-4-2-1-3-5-10/h1-5,7,9,12H,6,8H2,(H,15,16)(H,17,20)(H,18,19)/t12-/m0/s1 |
| InChIKey |
WCOJOHPAKJFUDF-LBPRGKRZSA-N |
| SMILES |
OC(=O)[C@H](Cc1c[nH]cn1)NC(=O)OCc2ccccc2 |
| CAS DataBase Reference |
14997-58-1(CAS DataBase Reference) |
