Chemical Properties
| Melting point | 218-220℃ (chloroform ) |
| Density | 1.78±0.1 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | DMSO: soluble |
| form | Off-white to fawn solid. |
| pka | 12.69±0.10(Predicted) |
| color | Off-white to fawn |
| biological source | mouse |
| InChIKey | ZRZWBWPDBOVIGQ-UHFFFAOYSA-N |
| SMILES | S1SC9(N(C(=O)C1(N(C9=O)C)CO)C)Cc2c3c([n](c2)C54C(N7C8(SSC(N(C8=O)C)(C7=O)CO)C5)Nc6c4cccc6)cccc3 |
Safety Information
| Hazard Codes | T |
| Risk Statements | 25 |
| Safety Statements | 45 |
| RIDADR | UN 2811 6.1 / PGIII |
| WGK Germany | 3 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |
| Toxicity | rat,LD50,oral,75mg/kg (75mg/kg),"CRC Handbook of Antibiotic Compounds," Vols.1- , Berdy, J., Boca Raton, FL, CRC Press, 1980Vol. 4(1), Pg. 174, 1980. |