(-)-alpha-[1-(Dibutylamino)ethyl]benzyl alcohol
- Product Name(-)-alpha-[1-(Dibutylamino)ethyl]benzyl alcohol
- CAS114389-70-7
- MFC17H29NO
- MW263.42
- EINECS
- MOL File114389-70-7.mol
Chemical Properties
| Boiling point | 170 °C2 mm Hg(lit.) |
| Density | 0.948 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | >230 °F |
| storage temp. | 2-8°C |
| pka | 13.91±0.20(Predicted) |
| form | clear liquid |
| color | Colorless to Light orange to Yellow |
| optical activity | [α]22/D -21°, c =2 in chloroform |
| InChI | 1S/C17H29NO/c1-4-6-13-18(14-7-5-2)15(3)17(19)16-11-9-8-10-12-16/h8-12,15,17,19H,4-7,13-14H2,1-3H3/t15-,17-/m1/s1 |
| InChIKey | BRRGNOFUBFINSX-NVXWUHKLSA-N |
| SMILES | CCCCN(CCCC)[C@H](C)[C@@H](O)c1ccccc1 |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 10 |
| HS Code | 29221990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |