![(-)-alpha-[1-(Dibutylamino)ethyl]benzyl alcohol Structure](https://www.chemicalbook.com/CAS/GIF/114389-70-7.gif)
(-)-alpha-[1-(Dibutylamino)ethyl]benzyl alcohol
- Product Name(-)-alpha-[1-(Dibutylamino)ethyl]benzyl alcohol
- CAS114389-70-7
- CBNumberCB4138325
- MFC17H29NO
- MW263.42
- MDL NumberMFCD00142695
- MOL File114389-70-7.mol
- MSDS FileSDS
Chemical Properties
| Boiling point | 170 °C2 mm Hg(lit.) |
| Density | 0.948 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | >230 °F |
| storage temp. | 2-8°C |
| pka | 13.91±0.20(Predicted) |
| form | clear liquid |
| color | Colorless to Light orange to Yellow |
| optical activity | [α]22/D -21°, c =2 in chloroform |
| InChI | 1S/C17H29NO/c1-4-6-13-18(14-7-5-2)15(3)17(19)16-11-9-8-10-12-16/h8-12,15,17,19H,4-7,13-14H2,1-3H3/t15-,17-/m1/s1 |
| InChIKey | BRRGNOFUBFINSX-NVXWUHKLSA-N |
| SMILES | CCCCN(CCCC)[C@H](C)[C@@H](O)c1ccccc1 |
| UNSPSC Code | 12352116 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H302+H312+H332-H315-H319-H335 | |||||||||
| Precautionary statements | P261-P305+P351+P338-P264-P270-P271-P280-P301+P312+P330-P302+P352+P312+P362+P364-P304+P340+P312-P305+P351+P338+P337+P313-P501 | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36/37/38 | |||||||||
| Safety Statements | 26-36 | |||||||||
| WGK Germany | 3 | |||||||||
| F | 10 | |||||||||
| HS Code | 29221990 | |||||||||
| Storage Class | 10 - Combustible liquids | |||||||||
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 | |||||||||
| NFPA 704: |
|
