alpha-Bromostyrene
- Product Namealpha-Bromostyrene
- CAS98-81-7
- MFC8H7Br
- MW183.05
- EINECS202-702-4
- MOL File98-81-7.mol
Chemical Properties
| Melting point | −44 °C (lit.) |
| Boiling point | 70 °C/4 mmHg |
| Density | 1.42 |
| refractive index | n 20/D 1.588 (lit.) |
| Flash point | 87 °C |
| storage temp. | 2-8°C |
| solubility | Chloroform, Methanol |
| form | clear liquid |
| color | Colorless to Yellow to Orange |
| InChI | InChI=1S/C8H7Br/c1-7(9)8-5-3-2-4-6-8/h2-6H,1H2 |
| InChIKey | SRXJYTZCORKVNA-UHFFFAOYSA-N |
| SMILES | C1(C(Br)=C)=CC=CC=C1 |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| RIDADR | NA 1993 / PGIII |
| WGK Germany | 3 |
| RTECS | WL3840000 |
| HazardClass | IRRITANT |
| HS Code | 29039990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
