(S)-3,3,3-Trifluoro-2-hydroxy-2-methylpropionic acid
- Product Name(S)-3,3,3-Trifluoro-2-hydroxy-2-methylpropionic acid
- CAS24435-45-8
- MFC4H5F3O3
- MW158.08
- EINECS
- MOL File24435-45-8.mol
Chemical Properties
| Melting point | 110 °C |
| Boiling point | 60-64°C 20mm |
| Density | 1.532±0.06 g/cm3 (20 ºC 760 Torr) |
| refractive index | -16.5 ° (C=5, H2O) |
| Flash point | 103.4±25.9℃ |
| storage temp. | Inert atmosphere,2-8°C |
| Water Solubility | Soluble in water |
| form | powder to crystal |
| pka | 2.46±0.22(Predicted) |
| color | White to Almost white |
| optical activity | Consistent with structure |
| InChI | InChI=1S/C4H5F3O3/c1-3(10,2(8)9)4(5,6)7/h10H,1H3,(H,8,9)/t3-/m0/s1 |
| InChIKey | CTGJACFEVDCYMC-VKHMYHEASA-N |
| SMILES | C(O)(=O)[C@@](O)(C)C(F)(F)F |
| CAS DataBase Reference | 24435-45-8(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN 3261 8/PG III |
| WGK Germany | WGK 3 |
| HazardClass | IRRITANT |
| PackingGroup | III |
| HS Code | 2918199890 |
| Storage Class | 11 - Combustible Solids |