| Melting point |
110 °C |
| Boiling point |
247.4±35.0℃ (760 Torr) |
| Density |
1.532±0.06 g/cm3 (20 ºC 760 Torr) |
| refractive index |
16.5 ° (C=5, H2O) |
| Flash point |
103.4±25.9℃ |
| storage temp. |
Inert atmosphere,2-8°C |
| Water Solubility |
Soluble in water |
| form |
powder to crystal |
| pka |
2.46±0.22(Predicted) |
| color |
White to Almost white |
| optical activity |
18.3° (C=1.00g/100ml, MEOH) |
| InChI |
InChI=1S/C4H5F3O3/c1-3(10,2(8)9)4(5,6)7/h10H,1H3,(H,8,9)/t3-/m1/s1 |
| InChIKey |
CTGJACFEVDCYMC-GSVOUGTGSA-N |
| SMILES |
C(O)(=O)[C@](O)(C)C(F)(F)F |
| CAS DataBase Reference |
44864-47-3(CAS DataBase Reference) |
