2-Fluoro-5-iodobenzaldehyde
- Product Name2-Fluoro-5-iodobenzaldehyde
- CAS146137-76-0
- MFC7H4FIO
- MW250.01
- EINECS
- MOL File146137-76-0.mol
Chemical Properties
| Melting point | 45-48 °C(lit.) |
| Boiling point | 261.9±25.0 °C(Predicted) |
| Density | 1.962±0.06 g/cm3(Predicted) |
| Flash point | >230 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| form | Crystals and Chunks |
| color | White to yellow |
| Sensitive | Air & Light Sensitive |
| InChI | InChI=1S/C7H4FIO/c8-7-2-1-6(9)3-5(7)4-10/h1-4H |
| InChIKey | BIRCCQCPGMMGPJ-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC(I)=CC=C1F |
| CAS DataBase Reference | 146137-76-0(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29130000 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |