1(alpha) 25-Dihydroxyvitamin D2*
- Product Name1(alpha) 25-Dihydroxyvitamin D2*
- CAS60133-18-8
- MFC28H44O3
- MW428.65
- EINECS634-659-6
- MOL File60133-18-8.mol
Chemical Properties
| Boiling point | 577.7±50.0 °C(Predicted) |
| Density | 1.06±0.1 g/cm3(Predicted) |
| Flash point | 14℃ |
| storage temp. | -20°C |
| solubility | Ethanol: 1 mg/ml |
| form | Powder |
| pka | 14.43±0.40(Predicted) |
| color | White to off-white |
| biological source | synthetic |
| BRN | 5635017 |
| Stability | Light sensitive, Temperature sensitive |
| InChIKey | ZGLHBRQAEXKACO-KYHOFSCESA-N |
| SMILES | [C@@H]1(O)C/C(=C/C=C2\CCC[C@@]3(C)[C@@]\2([H])CC[C@@H]3[C@H](C)/C=C/C(C)C(O)(C)C)/C(=C)[C@@H](O)C1 |
Safety Information
| Hazard Codes | T,T+,F |
| Risk Statements | 23/24/25-63-48/25-26-24/25-11 |
| Safety Statements | 36/37-45-28-16-7 |
| RIDADR | UN 2811 6.1/PG 2 |
| WGK Germany | 3 |
| F | 8-10-19 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Inhalation Acute Tox. 3 Dermal Acute Tox. 3 Oral STOT RE 1 Oral |