(Phenylsulfonyl)acetonitrile
- Product Name(Phenylsulfonyl)acetonitrile
- CAS7605-28-9
- MFC8H7NO2S
- MW181.21
- EINECS231-515-0
- MOL File7605-28-9.mol
Chemical Properties
| Melting point | 112-114 °C(lit.) |
| Boiling point | 398.5±34.0 °C(Predicted) |
| Density | 1.284±0.06 g/cm3 (20 ºC 760 Torr) |
| refractive index | 1.5650 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| color | White to Almost white |
| BRN | 640716 |
| InChI | InChI=1S/C8H7NO2S/c9-6-7-12(10,11)8-4-2-1-3-5-8/h1-5H,7H2 |
| InChIKey | ZFCFFNGBCVAUDE-UHFFFAOYSA-N |
| SMILES | C(#N)CS(C1=CC=CC=C1)(=O)=O |
| CAS DataBase Reference | 7605-28-9(CAS DataBase Reference) |
Safety Information
| Hazard Codes | T,Xi |
| Risk Statements | 23/24/25-36/37/38 |
| Safety Statements | 36/37/39-45-36-26 |
| RIDADR | 3276 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 2930909899 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |
