(Phenylsulfonyl)acetonitrile
- Product Name(Phenylsulfonyl)acetonitrile
- CAS7605-28-9
- CBNumberCB3473175
- MFC8H7NO2S
- MW181.21
- EINECS231-515-0
- MDL NumberMFCD00007550
- MOL File7605-28-9.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 112-114 °C(lit.) |
| Boiling point | 398.5±34.0 °C(Predicted) |
| Density | 1.284±0.06 g/cm3 (20 ºC 760 Torr) |
| refractive index | 1.5650 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| color | White to Almost white |
| BRN | 640716 |
| InChI | InChI=1S/C8H7NO2S/c9-6-7-12(10,11)8-4-2-1-3-5-8/h1-5H,7H2 |
| InChIKey | ZFCFFNGBCVAUDE-UHFFFAOYSA-N |
| SMILES | C(#N)CS(C1=CC=CC=C1)(=O)=O |
| CAS DataBase Reference | 7605-28-9(CAS DataBase Reference) |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H301+H311+H331 | |||||||||
| Precautionary statements | P261-P264-P280-P301+P310-P302+P352+P312-P304+P340+P311 | |||||||||
| Hazard Codes | T,Xi | |||||||||
| Risk Statements | 23/24/25-36/37/38 | |||||||||
| Safety Statements | 36/37/39-45-36-26 | |||||||||
| RIDADR | 3276 | |||||||||
| WGK Germany | 3 | |||||||||
| Hazard Note | Irritant | |||||||||
| HazardClass | 6.1 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 2930909899 | |||||||||
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | |||||||||
| Hazard Classifications | Acute Tox. 3 Oral | |||||||||
| NFPA 704: |
|
