Fluoroboric acid diethyl ether complex
- Product NameFluoroboric acid diethyl ether complex
- CAS67969-82-8
- MFC4H11BF4O
- MW161.93
- EINECS267-983-8
- MOL File67969-82-8.mol
Chemical Properties
| Density | 1.19 g/mL at 20 °C(lit.) |
| Flash point | −40 °F |
| storage temp. | 2-8°C |
| form | Liquid |
| color | Colorless to pale orange |
| Specific Gravity | 1.19 |
| Water Solubility | Reacts in water.Miscible with dichloromethane. |
| Merck | 14,4149 |
| InChI | InChI=1S/C4H10O.BF4/c1-3-5-4-2;2-1(3,4)5/h3-4H2,1-2H3;/q;-1/p+1 |
| InChIKey | XFHGDBFMJCLEOW-UHFFFAOYSA-N |
| SMILES | O(CC)CC.[B+3]([F-])([F-])([F-])[F-].[H+] |
| EPA Substance Registry System | Borate(1-), tetrafluoro-, hydrogen, compd. with 1,1'-oxybis[ethane] (1:1) (67969-82-8) |
Safety Information
| Hazard Codes | F,C |
| Risk Statements | 11-14-34 |
| Safety Statements | 26-36/37/39-43-45 |
| RIDADR | UN 3129 4.3/PG 2 |
| WGK Germany | 1 |
| F | 3 |
| TSCA | TSCA listed |
| HazardClass | 3 |
| PackingGroup | I |
| HS Code | 29091990 |
| Storage Class | 4.3 - Hazardous materials which set free flammable gases upon contact with water |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B Water-react 2 |
