Phenylethynyltri-n-butyltin
- Product NamePhenylethynyltri-n-butyltin
- CAS3757-88-8
- MFC20H32Sn
- MW391.18
- EINECS
- MOL File3757-88-8.mol
Chemical Properties
| Density | 1.116 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | >230 °F |
| storage temp. | Storage temp. -20°C |
| form | liquid |
| Specific Gravity | 1.116 |
| Appearance | Colorless to light yellow Liquid |
| Hydrolytic Sensitivity | 2: reacts with aqueous acid |
| InChI | 1S/C8H5.3C4H9.Sn/c1-2-8-6-4-3-5-7-8;3*1-3-4-2;/h3-7H;3*1,3-4H2,2H3; |
| InChIKey | PYMPTRMDPJYTDF-UHFFFAOYSA-N |
| SMILES | CCCC[Sn](CCCC)(CCCC)C#Cc1ccccc1 |
Safety Information
| Hazard Codes | T,N |
| Risk Statements | 21-25-36/38-48/23/25-50/53 |
| Safety Statements | 35-36/37/39-45-60-61 |
| RIDADR | UN 2788 6.1/PG 3 |
| WGK Germany | 3 |
| TSCA | No |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Acute Tox. 4 Dermal Aquatic Acute 1 Aquatic Chronic 1 Eye Irrit. 2 Repr. 1B Skin Irrit. 2 STOT RE 1 |