Tributylstannylacetylene
- Product NameTributylstannylacetylene
- CAS994-89-8
- MFC14H28Sn
- MW315.08
- EINECS628-819-4
- MOL File994-89-8.mol
Chemical Properties
| Boiling point | 70 °C0.2 mm Hg(lit.) |
| Density | 1.089 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | 165 °F |
| storage temp. | Sealed in dry,Store in freezer, under -20°C |
| form | liquid |
| Specific Gravity | 1.089 |
| Appearance | Colorless to light yellow Liquid |
| Water Solubility | Not miscible or difficult to mix with water. |
| Sensitive | Moisture Sensitive |
| BRN | 3537659 |
| InChI | InChI=1S/3C4H9.C2H.Sn/c3*1-3-4-2;1-2;/h3*1,3-4H2,2H3;1H; |
| InChIKey | YEMJHNYABQHWHL-UHFFFAOYSA-N |
| SMILES | [Sn](CCCC)(CCCC)(CCCC)C#C |
| CAS DataBase Reference | 994-89-8(CAS DataBase Reference) |
Safety Information
| Hazard Codes | T,N,Xn |
| Risk Statements | 21-25-36/38-48/23/25-50/53 |
| Safety Statements | 35-36/37/39-45-60-61 |
| RIDADR | UN 2788 6.1/PG 3 |
| WGK Germany | 3 |
| F | 21 |
| TSCA | No |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29319090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Acute Tox. 4 Dermal Aquatic Acute 1 Aquatic Chronic 1 Eye Irrit. 2 Repr. 1B Skin Irrit. 2 STOT RE 1 |