4-Chlorobenzhydrazide
- Product Name4-Chlorobenzhydrazide
- CAS536-40-3
- MFC7H7ClN2O
- MW170.6
- EINECS208-632-0
- MOL File536-40-3.mol
Chemical Properties
| Melting point | 162-165 °C (lit.) |
| Boiling point | 170.60°C |
| Density | 1.323 |
| refractive index | 1.5618 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 12.09±0.10(Predicted) |
| color | White to Almost white |
| BRN | 511154 |
| InChI | InChI=1S/C7H7ClN2O/c8-6-3-1-5(2-4-6)7(11)10-9/h1-4H,9H2,(H,10,11) |
| InChIKey | PKBGHORNUFQAAW-UHFFFAOYSA-N |
| SMILES | C(NN)(=O)C1=CC=C(Cl)C=C1 |
| CAS DataBase Reference | 536-40-3(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29280000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |