Naphthol as-bi beta-D-glucuronide
- Product NameNaphthol as-bi beta-D-glucuronide
- CAS37-87-6
- MFC24H22BrNO9
- MW548.34
- EINECS1533716-785-6
- MOL File37-87-6.mol
Chemical Properties
| Boiling point | 736.3±60.0 °C(Predicted) |
| Density | 1.695±0.06 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | NH4OH 1 M: 20 mg/mL, clear, faintly yellow |
| form | powder to crystal |
| pka | 2.74±0.70(Predicted) |
| color | White to Almost white |
| BRN | 6883214 |
| InChIKey | ACOOAEDFQKSZTC-NABGWTBKSA-N |
| SMILES | COc1ccccc1NC(=O)c2cc3cc(Br)ccc3cc2O[C@@H]4O[C@@H]([C@@H](O)[C@H](O)[C@H]4O)C(O)=O |
Safety Information
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| F | 10-21 |
| HS Code | 29329990 |
| Storage Class | 11 - Combustible Solids |