(1S,2R)-(+)-trans-2-Phenyl-1-cyclohexanol
- Product Name(1S,2R)-(+)-trans-2-Phenyl-1-cyclohexanol
- CAS34281-92-0
- MFC12H16O
- MW176.25
- EINECS
- MOL File34281-92-0.mol
Chemical Properties
| Melting point | 64-66 °C(lit.) |
| Boiling point | 276-281 °C(lit.) |
| Density | 0.9452 (rough estimate) |
| refractive index | 60 ° (C=10, MeOH) |
| storage temp. | 2-8°C |
| solubility | almost transparency in Methanol |
| form | powder to crystal |
| pka | 15.05±0.40(Predicted) |
| color | White to Almost white |
| optical activity | [α]20/D +58°, c = 7 in methanol |
| BRN | 4669439 |
| InChI | 1S/C12H16O/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-3,6-7,11-13H,4-5,8-9H2/t11-,12+/m1/s1 |
| InChIKey | AAIBYZBZXNWTPP-NEPJUHHUSA-N |
| SMILES | O[C@H]1CCCC[C@@H]1c2ccccc2 |
| CAS DataBase Reference | 34281-92-0(CAS DataBase Reference) |
Safety Information
| Safety Statements | 23-24/25 |
| WGK Germany | 3 |
| HS Code | 2906.29.6000 |
| Storage Class | 11 - Combustible Solids |
