3-Amino-4-methylphenylboronic acid hydrochloride
- Product Name3-Amino-4-methylphenylboronic acid hydrochloride
- CAS22237-12-3
- MFC7H10BNO2
- MW150.97
- EINECS681-828-5
- MOL File22237-12-3.mol
Chemical Properties
| Melting point | 250°C |
| Boiling point | 367.6±52.0 °C(Predicted) |
| Density | 1.19±0.1 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| form | powder to crystaline |
| pka | 8.77±0.10(Predicted) |
| color | White to Gray to Brown |
| InChI | InChI=1S/C7H10BNO2/c1-5-2-3-6(8(10)11)4-7(5)9/h2-4,10-11H,9H2,1H3 |
| InChIKey | PLTGUDDQNWJILD-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C)C(N)=C1)(O)O |
| CAS DataBase Reference | 22237-12-3(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36 |
| WGK Germany | WGK 3 |
| HazardClass | IRRITANT |
| HS Code | 29310095 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
