1,3-Cyclohexanedicarboxylic acid
- Product Name1,3-Cyclohexanedicarboxylic acid
- CAS3971-31-1
- MFC8H12O4
- MW172.18
- EINECS432-490-0
- MOL File3971-31-1.mol
Chemical Properties
| Melting point | 132-141 °C(lit.) |
| Boiling point | 332.4±25.0 °C(Predicted) |
| Density | 1.314±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 4.32±0.13(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C8H12O4/c9-7(10)5-2-1-3-6(4-5)8(11)12/h5-6H,1-4H2,(H,9,10)(H,11,12) |
| InChIKey | XBZSBBLNHFMTEB-UHFFFAOYSA-N |
| SMILES | C1(C(O)=O)CCCC(C(O)=O)C1 |
| CAS DataBase Reference | 3971-31-1(CAS DataBase Reference) |
| EPA Substance Registry System | 1,3-Cyclohexanedicarboxylic acid (3971-31-1) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-41 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29172090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |