3,4-Dichloroisocoumarin
- Product Name3,4-Dichloroisocoumarin
- CAS51050-59-0
- MFC9H4Cl2O2
- MW215.03
- EINECS
- MOL File51050-59-0.mol
Chemical Properties
| Boiling point | 304.7±42.0 °C(Predicted) |
| Density | 1.53±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Soluble in DMF or DMSO at a concentration of 10mM |
| form | White lyophilized solid |
| color | White to off-white |
| BRN | 6802625 |
| InChI | 1S/C9H4Cl2O2/c10-7-5-3-1-2-4-6(5)9(12)13-8(7)11/h1-4H |
| InChIKey | SUGXUUGGLDCZKB-UHFFFAOYSA-N |
| SMILES | ClC1=C(Cl)c2ccccc2C(=O)O1 |
Safety Information
| Hazard Codes | T |
| Risk Statements | 25-36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |