2-Nitro-4-cymene
- Product Name2-Nitro-4-cymene
- CAS943-15-7
- MFC10H13NO2
- MW179.22
- EINECS213-397-2
- MOL File943-15-7.mol
Chemical Properties
| Melting point | 1°C (estimate) |
| Boiling point | 134 °C / 15mmHg |
| Density | 1.07 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | >230 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| form | clear liquid |
| color | Light yellow to Yellow to Orange |
| InChI | 1S/C10H13NO2/c1-7(2)9-5-4-8(3)10(6-9)11(12)13/h4-7H,1-3H3 |
| InChIKey | DRKFWQDBPGTSOO-UHFFFAOYSA-N |
| SMILES | CC(C)c1ccc(C)c(c1)[N+]([O-])=O |
| EPA Substance Registry System | Benzene, 1-methyl-4-(1-methylethyl)-2-nitro- (943-15-7) |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 36/37/39-26 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 2904200090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral |