TRIISOBUTYLCHLOROSILANE
- Product NameTRIISOBUTYLCHLOROSILANE
- CAS13154-25-1
- MFC12H27ClSi
- MW234.88
- EINECS454-150-0
- MOL File13154-25-1.mol
Chemical Properties
| Boiling point | 225-8°C |
| Density | 0.875 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | 190 °F |
| storage temp. | Store at room temperature, keep dry and cool |
| Specific Gravity | 0.877 |
| Appearance | Colorless to light yellow Liquid |
| Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents |
| BRN | 2409275 |
| InChI | 1S/C12H27ClSi/c1-10(2)7-14(13,8-11(3)4)9-12(5)6/h10-12H,7-9H2,1-6H3 |
| InChIKey | TZPZCTBZJKZFGY-UHFFFAOYSA-N |
| SMILES | CC(C)C[Si](Cl)(CC(C)C)CC(C)C |
Safety Information
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 2987 8/PG 2 |
| WGK Germany | 3 |
| F | 10-21 |
| TSCA | No |
| HazardClass | 8 |
| PackingGroup | II |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
