5,10-Dimethyldihydrophenazine
- Product Name5,10-Dimethyldihydrophenazine
- CAS15546-75-5
- MFC14H14N2
- MW210.27
- EINECS203-037-2
- MOL File15546-75-5.mol
Chemical Properties
| Melting point | 150-152 °C (dec.)(lit.) |
| Boiling point | 339.4±12.0 °C(Predicted) |
| Density | 1.117±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Toluene |
| form | powder to crystal |
| pka | 3.82±0.20(Predicted) |
| color | White to Light yellow |
| InChI | InChI=1S/C14H14N2/c1-15-11-7-3-5-9-13(11)16(2)14-10-6-4-8-12(14)15/h3-10H,1-2H3 |
| InChIKey | GVTGSIMRZRYNEI-UHFFFAOYSA-N |
| SMILES | C1=C2C(N(C)C3=C(N2C)C=CC=C3)=CC=C1 |
| CAS DataBase Reference | 15546-75-5(CAS DataBase Reference) |
Safety Information
| Hazard Codes | T |
| Risk Statements | 23/24/25-36/37/38 |
| Safety Statements | 26-28-36/37/39-45 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 2933990099 |
