Baicalein 7-O-β-D-glucopyranoside (baicalin)
- Product NameBaicalein 7-O-β-D-glucopyranoside (baicalin)
- CAS57396-78-8
- MFC21H20O10
- MW432.38
- EINECS
- MOL File57396-78-8.mol
Chemical Properties
| Boiling point | 784.0±60.0 °C(Predicted) |
| Density | 1.642±0.06 g/cm3 (20 ºC 760 Torr) |
| storage temp. | 2-8°C(protect from light) |
| solubility | Soluble in methanol and water |
| form | powder |
| pka | 5.92±0.40(Predicted) |
| color | Yellow |
| Major Application | food and beverages |
| InChIKey | IPQKDIRUZHOIOM-IAAKTDFRSA-N |
| SMILES | OC1C(=C(C=C2OC(C3C=CC=CC=3)=CC(C2=1)=O)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O)O |
Safety Information
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
