BIS(2-ETHYLHEXYL)ISOPHTHALATE
- Product NameBIS(2-ETHYLHEXYL)ISOPHTHALATE
- CAS137-89-3
- MFC24H38O4
- MW390.56
- EINECS205-308-0
- MOL File137-89-3.mol
Chemical Properties
| Melting point | -46 |
| Boiling point | 211°C/2mmHg(lit.) |
| Density | 1.0101 (rough estimate) |
| refractive index | 1.4860 to 1.4900 |
| Flash point | 233°C(lit.) |
| storage temp. | Refrigerator, under inert atmosphere |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Liquid |
| color | Colourless |
| Water Solubility | 11ug/L(24 ºC) |
| BRN | 2162836 |
| Major Application | cleaning products cosmetics food and beverages personal care |
| InChI | 1S/C24H38O4/c1-5-9-12-19(7-3)17-27-23(25)21-14-11-15-22(16-21)24(26)28-18-20(8-4)13-10-6-2/h11,14-16,19-20H,5-10,12-13,17-18H2,1-4H3 |
| InChIKey | WXZOXVVKILCOPG-UHFFFAOYSA-N |
| SMILES | O(CC(CCCC)CC)C(=O)c1cc(ccc1)C(=O)OCC(CCCC)CC |
| EPA Substance Registry System | Bis(2-ethylhexyl) isophthalate (137-89-3) |
Safety Information
| Hazard Codes | T,N |
| Risk Statements | 60-61-50 |
| Safety Statements | 53-45-61 |
| RIDADR | UN 3082 9 / PGIII |
| WGK Germany | 3 |
| RTECS | NT2050000 |
| TSCA | TSCA listed |
| HS Code | 2917.39.7000 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Aquatic Acute 1 Repr. 1B |