| Melting point |
96.0 to 100.0 °C |
| Boiling point |
522.6±50.0 °C(Predicted) |
| Density |
1+-.0.06 g/cm3(Predicted) |
| storage temp. |
Keep in dark place,Sealed in dry,Room Temperature |
| solubility |
soluble in Methanol |
| form |
powder to crystal |
| pka |
4.48±0.10(Predicted) |
| color |
White to Almost white |
| optical activity |
Consistent with structure |
| BRN |
4154458 |
| Major Application |
peptide synthesis |
| InChI |
1S/C17H23NO6/c1-17(2,3)24-16(22)18-13(9-10-14(19)20)15(21)23-11-12-7-5-4-6-8-12/h4-8,13H,9-11H2,1-3H3,(H,18,22)(H,19,20)/t13-/m1/s1 |
| InChIKey |
CVZUKWBYQQYBTF-CYBMUJFWSA-N |
| SMILES |
CC(C)(C)OC(=O)N[C@H](CCC(O)=O)C(=O)OCc1ccccc1 |
| CAS DataBase Reference |
34404-30-3(CAS DataBase Reference) |
