3-Methyl-2,4-pentanedione
- Product Name3-Methyl-2,4-pentanedione
- CAS815-57-6
- MFC6H10O2
- MW114.14
- EINECS212-420-3
- MOL File815-57-6.mol
Chemical Properties
| Melting point | -7.75°C (estimate) |
| Boiling point | 172-174 °C(lit.) |
| Density | 0.981 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | 134 °F |
| storage temp. | Inert atmosphere,2-8°C |
| pka | pK1:10.87 (25°C) |
| form | clear liquid |
| color | Light yellow to Yellow to Green |
| Water Solubility | Soluble in water. |
| BRN | 635909 |
| InChI | InChI=1S/C6H10O2/c1-4(5(2)7)6(3)8/h4H,1-3H3 |
| InChIKey | GSOHKPVFCOWKPU-UHFFFAOYSA-N |
| SMILES | CC(=O)C(C)C(=O)C |
| LogP | 0.623 (est) |
| CAS DataBase Reference | 815-57-6(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| RIDADR | UN 1224 3/PG 3 |
| WGK Germany | 3 |
| HS Code | 2914.19.0000 |
| HazardClass | 3 |
| PackingGroup | III |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |
