| Melting point |
191-194 °C |
| Boiling point |
235.5°C (rough estimate) |
| Density |
1.3293 (rough estimate) |
| refractive index |
1.4330 (estimate) |
| storage temp. |
Sealed in dry,Room Temperature |
| solubility |
DMSO (Slightly), Methanol (Slightly) |
| pka |
3.13±0.10(Predicted) |
| form |
Powder |
| color |
White to off-white |
| Water Solubility |
Slightly miscible with water. |
| InChI |
InChI=1S/C8H6O5/c9-4-1-2-5(7(10)11)6(3-4)8(12)13/h1-3,9H,(H,10,11)(H,12,13) |
| InChIKey |
MWRVRCAFWBBXTL-UHFFFAOYSA-N |
| SMILES |
C1(C(O)=O)=CC=C(O)C=C1C(O)=O |
| CAS DataBase Reference |
610-35-5(CAS DataBase Reference) |
| EPA Substance Registry System |
1,2-Benzenedicarboxylic acid, 4-hydroxy- (610-35-5) |
