Tributyltin trifluoromethanesulfonate
- Product NameTributyltin trifluoromethanesulfonate
- CAS68725-14-4
- MFC13H27F3O3SSn
- MW439.12
- EINECS
- MOL File68725-14-4.mol
Chemical Properties
| Melting point | 31 °C |
| Boiling point | 56 °C |
| Flash point | >230 °F |
| storage temp. | 2-8°C |
| form | Crystals and Chunks |
| color | White to light beige |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| Sensitive | Moisture Sensitive |
| BRN | 5818090 |
| Exposure limits | ACGIH: TWA 0.1 mg/m3; STEL 0.2 mg/m3 (Skin) NIOSH: IDLH 25 mg/m3; TWA 0.1 mg/m3 |
| InChI | 1S/3C4H9.CHF3O3S.Sn/c3*1-3-4-2;2-1(3,4)8(5,6)7;/h3*1,3-4H2,2H3;(H,5,6,7);/q;;;;+1/p-1 |
| InChIKey | LIQOILBASIAIQC-UHFFFAOYSA-M |
| SMILES | CCCC[Sn](CCCC)(CCCC)OS(=O)(=O)C(F)(F)F |
Safety Information
| Hazard Codes | T,N |
| Risk Statements | 21-25-36/38-48/23/25-50/53 |
| Safety Statements | 35-36/37/39-45-60-61 |
| RIDADR | UN 1760 8/PG 2 |
| WGK Germany | 3 |
| F | 3-8-10-21 |
| TSCA | No |
| HazardClass | 6.1(a) |
| PackingGroup | II |
| HS Code | 29312000 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Acute Tox. 4 Dermal Aquatic Acute 1 Aquatic Chronic 1 Eye Irrit. 2 Repr. 1B Skin Irrit. 2 STOT RE 1 |
