Tributyltin trifluoromethanesulfonate
- Product NameTributyltin trifluoromethanesulfonate
- CAS68725-14-4
- CBNumberCB2723776
- MFC13H27F3O3SSn
- MW439.12
- MDL NumberMFCD00043324
- MOL File68725-14-4.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 31 °C |
| Boiling point | 56 °C |
| Flash point | >230 °F |
| storage temp. | 2-8°C |
| form | Crystals and Chunks |
| color | White to light beige |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| Sensitive | Moisture Sensitive |
| BRN | 5818090 |
| Exposure limits | ACGIH: TWA 0.1 mg/m3; STEL 0.2 mg/m3 (Skin) NIOSH: IDLH 25 mg/m3; TWA 0.1 mg/m3 |
| InChI | 1S/3C4H9.CHF3O3S.Sn/c3*1-3-4-2;2-1(3,4)8(5,6)7;/h3*1,3-4H2,2H3;(H,5,6,7);/q;;;;+1/p-1 |
| InChIKey | LIQOILBASIAIQC-UHFFFAOYSA-M |
| SMILES | CCCC[Sn](CCCC)(CCCC)OS(=O)(=O)C(F)(F)F |
| UNSPSC Code | 12352103 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
  
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H301-H312-H315-H319-H360FD-H372-H410 | |||||||||
| Precautionary statements | P202-P273-P280-P301+P310-P302+P352+P312-P305+P351+P338 | |||||||||
| Hazard Codes | T,N | |||||||||
| Risk Statements | 21-25-36/38-48/23/25-50/53 | |||||||||
| Safety Statements | 35-36/37/39-45-60-61 | |||||||||
| RIDADR | UN 1760 8/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| F | 3-8-10-21 | |||||||||
| TSCA | No | |||||||||
| HazardClass | 6.1(a) | |||||||||
| PackingGroup | II | |||||||||
| HS Code | 29312000 | |||||||||
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | |||||||||
| Hazard Classifications | Acute Tox. 3 Oral Acute Tox. 4 Dermal Aquatic Acute 1 Aquatic Chronic 1 Eye Irrit. 2 Repr. 1B Skin Irrit. 2 STOT RE 1 | |||||||||
| NFPA 704: |
|
