| Melting point |
267 °C (dec.)(lit.) |
| alpha |
[α]D20 -0.5～+0.5゜ (c=8, HCl) |
| storage temp. |
Keep in dark place,Inert atmosphere,Room temperature |
| solubility |
H2O: soluble |
| form |
Powder, Granules or Chunks |
| color |
White |
| Water Solubility |
Soluble in water. Insoluble in ethanol, ethyl ether, acetone, benzene and common neutral solvents. |
| BRN |
4711993 |
| Stability |
Stable. Incompatible with strong oxidizing agents. |
| InChI |
InChI=1S/C6H14N2O2.ClH/c7-4-2-1-3-5(8)6(9)10;/h5H,1-4,7-8H2,(H,9,10);1H |
| InChIKey |
BVHLGVCQOALMSV-UHFFFAOYSA-N |
| SMILES |
C(O)(=O)C(CCCCN)N.[H]Cl |
| CAS DataBase Reference |
70-53-1(CAS DataBase Reference) |
| EPA Substance Registry System |
Lysine monohydrochloride (70-53-1) |
