Tralkoxydim
- Product NameTralkoxydim
- CAS87820-88-0
- MFC20H27NO3
- MW329.43
- EINECS252-615-0
- MOL File87820-88-0.mol
Chemical Properties
| Melting point | 106° |
| Boiling point | 467.02°C (rough estimate) |
| Density | 1.1213 (rough estimate) |
| refractive index | 1.5614 (estimate) |
| Flash point | >100 °C |
| storage temp. | 0-6°C |
| solubility | soluble in dichloromethane,Toluene,Acetone |
| pka | 4.20±0.25(Predicted) |
| color | Light yellow to Yellow to Orange |
| Merck | 14,9564 |
| BRN | 8577523 |
| Henry's Law Constant | 4.1×104 mol/(m3Pa) at 25℃, HSDB (2015) |
| InChI | InChI=1S/C20H27NO3/c1-6-16(21-24-7-2)20-17(22)10-15(11-18(20)23)19-13(4)8-12(3)9-14(19)5/h8-9,15,22H,6-7,10-11H2,1-5H3 |
| InChIKey | DQFPEYARZIQXRM-UHFFFAOYSA-N |
| SMILES | C1(=O)CC(C2=C(C)C=C(C)C=C2C)CC(O)=C1C(=NOCC)CC |
| LogP | 4.460 |
| CAS DataBase Reference | 87820-88-0(CAS DataBase Reference) |
| EPA Substance Registry System | Tralkoxydim (87820-88-0) |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 22 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 3 |
| RTECS | GW7191600 |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29280000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 2 Carc. 2 |
| Hazardous Substances Data | 87820-88-0(Hazardous Substances Data) |
| Toxicity | LD50 orally in male and female rats, male and female mice, male rabbit (mg/kg): 1324, 934, 1231, 1100, 519; dermally in male and female rats: >2000, >2000 mg/kg (Warner 1987) |