3,6-Di-2-pyridyl-1,2,4,5-tetrazine
- Product Name3,6-Di-2-pyridyl-1,2,4,5-tetrazine
- CAS1671-87-0
- MFC12H8N6
- MW236.23
- EINECS
- MOL File1671-87-0.mol
Chemical Properties
| Melting point | 225 °C (dec.) (lit.) |
| Boiling point | 509.1±48.0 °C(Predicted) |
| Density | 1.317±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| pka | -1.77±0.11(Predicted) |
| color | Red to Dark red to Brown |
| Water Solubility | Slightly soluble in water. |
| InChI | InChI=1S/C12H8N6/c1-3-7-13-9(5-1)11-15-17-12(18-16-11)10-6-2-4-8-14-10/h1-8H |
| InChIKey | JFBIRMIEJBPDTQ-UHFFFAOYSA-N |
| SMILES | N1C(C2=NC=CC=C2)=NN=C(C2=NC=CC=C2)N=1 |
| CAS DataBase Reference | 1671-87-0 |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |