N-Acetylneuraminic acid methyl ester
- Product NameN-Acetylneuraminic acid methyl ester
- CAS22900-11-4
- MFC12H21NO9
- MW323.3
- EINECS
- MOL File22900-11-4.mol
Chemical Properties
| Melting point | 193.5-194.5°C |
| Boiling point | 693.8±55.0 °C(Predicted) |
| Density | 1.51±0.1 g/cm3(Predicted) |
| refractive index | -27.5 ° (C=1, H2O) |
| storage temp. | Freezer |
| Water Solubility | Slightly soluble in water |
| solubility | soluble in Methanol |
| pka | 10.40±0.70(Predicted) |
| form | powder to crystal |
| color | White to Almost white |
| InChI | InChI=1/C12H21NO9/c1-5(15)13-8-6(16)3-12(20,11(19)21-2)22-10(8)9(18)7(17)4-14/h6-10,14,16-18,20H,3-4H2,1-2H3,(H,13,15)/t6-,7+,8+,9+,10+,12-/s3 |
| InChIKey | BKZQMWNJESHHSA-AGNBLMTLSA-N |
| SMILES | [C@@H]([C@]1([H])O[C@](O)(C(=O)OC)C[C@H](O)[C@H]1NC(=O)C)(O)[C@H](O)CO |&1:0,1,4,11,13,19,r| |
| CAS DataBase Reference | 22900-11-4 |