4-Fluorobenzenesulfonamide
- Product Name4-Fluorobenzenesulfonamide
- CAS402-46-0
- MFC6H6FNO2S
- MW175.18
- EINECS206-946-2
- MOL File402-46-0.mol
Chemical Properties
| Melting point | 124-127 °C (lit.) |
| Boiling point | 307.9±44.0 °C(Predicted) |
| Density | 1.428±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 10.00±0.10(Predicted) |
| color | White to Almost white |
| Water Solubility | It is soluble in water. |
| InChI | InChI=1S/C6H6FNO2S/c7-5-1-3-6(4-2-5)11(8,9)10/h1-4H,(H2,8,9,10) |
| InChIKey | LFLSATHZMYYIAQ-UHFFFAOYSA-N |
| SMILES | C1(S(N)(=O)=O)=CC=C(F)C=C1 |
| CAS DataBase Reference | 402-46-0(CAS DataBase Reference) |
Safety Information
| Hazard Codes | T,Xi |
| Risk Statements | 23/24/25-36/37/38 |
| Safety Statements | 26-36-45 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | DB2630000 |
| Hazard Note | Irritant/Toxic |
| HazardClass | IRRITANT |
| HS Code | 29350090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
