3-(4-Methoxybenzoyl)propionic acid
- Product Name3-(4-Methoxybenzoyl)propionic acid
- CAS3153-44-4
- MFC11H12O4
- MW208.21
- EINECS221-593-4
- MOL File3153-44-4.mol
Chemical Properties
| Melting point | 148-150 °C(lit.) |
| Boiling point | 307.4°C (rough estimate) |
| Density | 1.2252 (rough estimate) |
| refractive index | 1.5020 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 4.58±0.17(Predicted) |
| color | White to Orange to Green |
| Water Solubility | 18g/L at 25℃ |
| BRN | 785074 |
| InChI | InChI=1S/C11H12O4/c1-15-9-4-2-8(3-5-9)10(12)6-7-11(13)14/h2-5H,6-7H2,1H3,(H,13,14) |
| InChIKey | OMTDIBZSUZNVJK-UHFFFAOYSA-N |
| SMILES | C1(C=CC(OC)=CC=1)C(=O)CCC(=O)O |
| LogP | 1.38 |
| CAS DataBase Reference | 3153-44-4(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
