Catechol bis(trifluoromethanesulfonate)
- Product NameCatechol bis(trifluoromethanesulfonate)
- CAS17763-91-6
- MFC8H4F6O6S2
- MW374.23
- EINECS
- MOL File17763-91-6.mol
Chemical Properties
| Melting point | 37-40 °C(lit.) |
| Boiling point | 92-95 °C1 mm Hg(lit.) |
| Density | 1.7186 (estimate) |
| Flash point | >230 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| color | White to Almost white |
| InChI | InChI=1S/C8H4F6O6S2/c9-7(10,11)21(15,16)19-5-3-1-2-4-6(5)20-22(17,18)8(12,13)14/h1-4H |
| InChIKey | XISAIQHXAICQIV-UHFFFAOYSA-N |
| SMILES | C1(OS(C(F)(F)F)(=O)=O)=CC=CC=C1OS(C(F)(F)F)(=O)=O |
Safety Information
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-27-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29049090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
