Phenyl trifluoromethanesulfonate
- Product NamePhenyl trifluoromethanesulfonate
- CAS17763-67-6
- MFC7H5F3O3S
- MW226.17
- EINECS
- MOL File17763-67-6.mol
Chemical Properties
| Boiling point | 99-100 °C/60 mmHg (lit.) |
| Density | 1.396 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | 160 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| form | clear liquid |
| color | Colorless to Almost colorless |
| InChI | InChI=1S/C7H5F3O3S/c8-7(9,10)14(11,12)13-6-4-2-1-3-5-6/h1-5H |
| InChIKey | GRJHONXDTNBDTC-UHFFFAOYSA-N |
| SMILES | C(F)(F)(F)S(OC1=CC=CC=C1)(=O)=O |
Safety Information
| Hazard Codes | T |
| Risk Statements | 36/37/38-34-24/25 |
| Safety Statements | 26-36-45-36/37/39 |
| RIDADR | UN 2927 6.1/PG 2 |
| WGK Germany | 3 |
| HazardClass | 6.1, 8 |
| HS Code | 29049090 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 3 Oral Skin Corr. 1B |