4-Pyridazinecarboxylic acid
- Product Name4-Pyridazinecarboxylic acid
- CAS50681-25-9
- MFC5H4N2O2
- MW124.1
- EINECS610-561-9
- MOL File50681-25-9.mol
Chemical Properties
| Melting point | 244.2 °C (dec.) (lit.) |
| Boiling point | 404.2±18.0 °C(Predicted) |
| Density | 1.403±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 3.18±0.10(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C5H4N2O2/c8-5(9)4-1-2-6-7-3-4/h1-3H,(H,8,9) |
| InChIKey | JUSIWJONLKBPDU-UHFFFAOYSA-N |
| SMILES | C1=NN=CC=C1C(O)=O |
| CAS DataBase Reference | 50681-25-9(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
