Ethyl 4-hydroxycyclohexanecarboxylate
- Product NameEthyl 4-hydroxycyclohexanecarboxylate
- CAS17159-80-7
- MFC9H16O3
- MW172.22
- EINECS241-215-1
- MOL File17159-80-7.mol
Chemical Properties
| Boiling point | 127-134 °C0.1 mm Hg(lit.) |
| Density | 1.068 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | >230 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| pka | 14.98±0.40(Predicted) |
| form | liquid |
| Specific Gravity | 1.068 |
| Appearance | Colorless to light yellow Liquid |
| Water Solubility | Not miscible or difficult to mix in water. |
| InChI | InChI=1S/C9H16O3/c1-2-12-9(11)7-3-5-8(10)6-4-7/h7-8,10H,2-6H2,1H3 |
| InChIKey | BZKQJSLASWRDNE-UHFFFAOYSA-N |
| SMILES | C1(C(OCC)=O)CCC(O)CC1 |
| CAS DataBase Reference | 17159-80-7 |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 2918199890 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |