Bis(2,4-dinitrophenyl) oxalate
- Product NameBis(2,4-dinitrophenyl) oxalate
- CAS16536-30-4
- MFC14H6N4O12
- MW422.22
- EINECS
- MOL File16536-30-4.mol
Chemical Properties
| Melting point | 189-190 °C(lit.) |
| Boiling point | 605.1±55.0 °C(Predicted) |
| Density | 1.759±0.06 g/cm3(Predicted) |
| storage temp. | −20°C |
| solubility | soluble in Benzene,Toluene |
| form | powder to crystal |
| color | White to Light yellow |
| Stability | Stable. Incompatible with strong oxidizing agents, strong bases. |
| InChI | 1S/C14H6N4O12/c19-13(29-11-3-1-7(15(21)22)5-9(11)17(25)26)14(20)30-12-4-2-8(16(23)24)6-10(12)18(27)28/h1-6H |
| InChIKey | CBZOGAWUNMFXFQ-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1ccc(OC(=O)C(=O)Oc2ccc(cc2[N+]([O-])=O)[N+]([O-])=O)c(c1)[N+]([O-])=O |
| CAS DataBase Reference | 16536-30-4(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN 1325 4.1/PG II |
| WGK Germany | 3 |
| F | 8-10-21 |
| HS Code | 2914.50.5000 |
| HazardClass | 4.1 |
| PackingGroup | II |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |