2,5-Dibromo-3-aminopyridine
- Product Name2,5-Dibromo-3-aminopyridine
- CAS90902-84-4
- MFC5H4Br2N2
- MW251.91
- EINECS
- MOL File90902-84-4.mol
Chemical Properties
| Melting point | 152.0 to 156.0 °C |
| Boiling point | 325.0±37.0 °C(Predicted) |
| Density | 2.147±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | -0.56±0.10(Predicted) |
| color | White to Brown |
| InChI | InChI=1S/C5H4Br2N2/c6-3-1-4(8)5(7)9-2-3/h1-2H,8H2 |
| InChIKey | VHGBUYMPBFPXQM-UHFFFAOYSA-N |
| SMILES | C1(Br)=NC=C(Br)C=C1N |
| CAS DataBase Reference | 90902-84-4 |
Safety Information
| Hazard Codes | Xi,T |
| Risk Statements | 25-41 |
| Safety Statements | 26-39-45 |
| RIDADR | UN 2811 6.1 / PGIII |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2933399990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Dam. 1 |